C23H18BrNO3 — CID 1020391
(3Z)-5-bromo-3-[(3-methoxy-4-phenylmethoxyphenyl)methylidene]-1H-indol-2-one (PubChem CID 1020391) has the molecular formula C23H18BrNO3 and a molecular weight of 436.31 g/mol. Its IUPAC name is (3Z)-5-bromo-3-[(3-methoxy-4-phenylmethoxyphenyl)methylidene]-1H-indol-2-one.
| Compound Name | (3Z)-5-bromo-3-[(3-methoxy-4-phenylmethoxyphenyl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 1020391 |
| Molecular Formula | C23H18BrNO3 |
| Molecular Weight | 436.31 g/mol |
| Exact Mass | 435.05 |
| IUPAC Name | (3Z)-5-bromo-3-[(3-methoxy-4-phenylmethoxyphenyl)methylidene]-1H-indol-2-one |
| SMILES | COc1cc(/C=C2\C(=O)Nc3ccc(Br)cc32)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C23H18BrNO3/c1-27-22-12-16(7-10-21(22)28-14-15-5-3-2-4-6-15)11-19-18-13-17(24)8-9-20(18)25-23(19)26/h2-13H,14H2,1H3,(H,25,26)/b19-11- |
| InChIKey | SHKNYOUQAKUGJB-ODLFYWEKSA-N |
| XLogP | 5.53 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.31 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|