C35H28BrNO3 — CID 70252141
5-bromo-3-[(4-methoxy-3-phenylphenyl)methylidene]-1H-indol-2-one;1-methoxy-2-phenylbenzene (PubChem CID 70252141) has the molecular formula C35H28BrNO3 and a molecular weight of 590.52 g/mol. Its IUPAC name is 5-bromo-3-[(4-methoxy-3-phenylphenyl)methylidene]-1H-indol-2-one;1-methoxy-2-phenylbenzene.
| Compound Name | 5-bromo-3-[(4-methoxy-3-phenylphenyl)methylidene]-1H-indol-2-one;1-methoxy-2-phenylbenzene |
|---|---|
| PubChem CID | 70252141 |
| Molecular Formula | C35H28BrNO3 |
| Molecular Weight | 590.52 g/mol |
| Exact Mass | 589.13 |
| IUPAC Name | 5-bromo-3-[(4-methoxy-3-phenylphenyl)methylidene]-1H-indol-2-one;1-methoxy-2-phenylbenzene |
| SMILES | COc1ccc(C=C2C(=O)Nc3ccc(Br)cc32)cc1-c1ccccc1.COc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C22H16BrNO2.C13H12O/c1-26-21-10-7-14(11-17(21)15-5-3-2-4-6-15)12-19-18-13-16(23)8-9-20(18)24-22(19)25;1-14-13-10-6-5-9-12(13)11-7-3-2-4-8-11/h2-13H,1H3,(H,24,25);2-10H,1H3 |
| InChIKey | SNSDKFFYNZHXEQ-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.52 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|