C16H12BrNO2 — CID 5147801
5-bromo-3-[(2-methoxyphenyl)methylidene]-1H-indol-2-one (PubChem CID 5147801) has the molecular formula C16H12BrNO2 and a molecular weight of 330.18 g/mol. Its IUPAC name is 5-bromo-3-[(2-methoxyphenyl)methylidene]-1H-indol-2-one.
| Compound Name | 5-bromo-3-[(2-methoxyphenyl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 5147801 |
| Molecular Formula | C16H12BrNO2 |
| Molecular Weight | 330.18 g/mol |
| Exact Mass | 329.01 |
| IUPAC Name | 5-bromo-3-[(2-methoxyphenyl)methylidene]-1H-indol-2-one |
| SMILES | COc1ccccc1C=C1C(=O)Nc2ccc(Br)cc21 |
| InChI | InChI=1S/C16H12BrNO2/c1-20-15-5-3-2-4-10(15)8-13-12-9-11(17)6-7-14(12)18-16(13)19/h2-9H,1H3,(H,18,19) |
| InChIKey | RNSAFAZBKHRUAT-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.18 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|