C17H14BrNO3 — CID 5079357
5-bromo-3-[(3-ethoxy-4-hydroxyphenyl)methylidene]-1H-indol-2-one (PubChem CID 5079357) has the molecular formula C17H14BrNO3 and a molecular weight of 360.21 g/mol. Its IUPAC name is 5-bromo-3-[(3-ethoxy-4-hydroxyphenyl)methylidene]-1H-indol-2-one.
| Compound Name | 5-bromo-3-[(3-ethoxy-4-hydroxyphenyl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 5079357 |
| Molecular Formula | C17H14BrNO3 |
| Molecular Weight | 360.21 g/mol |
| Exact Mass | 359.02 |
| IUPAC Name | 5-bromo-3-[(3-ethoxy-4-hydroxyphenyl)methylidene]-1H-indol-2-one |
| SMILES | CCOc1cc(C=C2C(=O)Nc3ccc(Br)cc32)ccc1O |
| InChI | InChI=1S/C17H14BrNO3/c1-2-22-16-8-10(3-6-15(16)20)7-13-12-9-11(18)4-5-14(12)19-17(13)21/h3-9,20H,2H2,1H3,(H,19,21) |
| InChIKey | IPVJIRQIMXWSAT-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.21 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|