C26H23ClN2O5 — CID 89220545
methyl (2R)-2-(chloroamino)-3-[4-[2-methoxy-4-[(E)-(2-oxo-1H-indol-3-ylidene)methyl]phenoxy]phenyl]propanoate (PubChem CID 89220545) has the molecular formula C26H23ClN2O5 and a molecular weight of 478.93 g/mol. Its IUPAC name is methyl (2R)-2-(chloroamino)-3-[4-[2-methoxy-4-[(E)-(2-oxo-1H-indol-3-ylidene)methyl]phenoxy]phenyl]propanoate.
| Compound Name | methyl (2R)-2-(chloroamino)-3-[4-[2-methoxy-4-[(E)-(2-oxo-1H-indol-3-ylidene)methyl]phenoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 89220545 |
| Molecular Formula | C26H23ClN2O5 |
| Molecular Weight | 478.93 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | methyl (2R)-2-(chloroamino)-3-[4-[2-methoxy-4-[(E)-(2-oxo-1H-indol-3-ylidene)methyl]phenoxy]phenyl]propanoate |
| SMILES | COC(=O)[C@@H](Cc1ccc(Oc2ccc(/C=C3/C(=O)Nc4ccccc43)cc2OC)cc1)NCl |
| InChI | InChI=1S/C26H23ClN2O5/c1-32-24-15-17(13-20-19-5-3-4-6-21(19)28-25(20)30)9-12-23(24)34-18-10-7-16(8-11-18)14-22(29-27)26(31)33-2/h3-13,15,22,29H,14H2,1-2H3,(H,28,30)/b20-13+/t22-/m1/s1 |
| InChIKey | KCGFGAPKOQUQLO-WVWKGNOCSA-N |
| XLogP | 4.81 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.93 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|