C24H20N2O4 — CID 69237217
2-amino-3-[4-[4-[(2-oxo-1H-indol-3-ylidene)methyl]phenoxy]phenyl]propanoic acid (PubChem CID 69237217) has the molecular formula C24H20N2O4 and a molecular weight of 400.43 g/mol. Its IUPAC name is 2-amino-3-[4-[4-[(2-oxo-1H-indol-3-ylidene)methyl]phenoxy]phenyl]propanoic acid.
| Compound Name | 2-amino-3-[4-[4-[(2-oxo-1H-indol-3-ylidene)methyl]phenoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 69237217 |
| Molecular Formula | C24H20N2O4 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 2-amino-3-[4-[4-[(2-oxo-1H-indol-3-ylidene)methyl]phenoxy]phenyl]propanoic acid |
| SMILES | NC(Cc1ccc(Oc2ccc(C=C3C(=O)Nc4ccccc43)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C24H20N2O4/c25-21(24(28)29)14-16-7-11-18(12-8-16)30-17-9-5-15(6-10-17)13-20-19-3-1-2-4-22(19)26-23(20)27/h1-13,21H,14,25H2,(H,26,27)(H,28,29) |
| InChIKey | VADOCBKEWZWAMO-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|