C26H21F3N2O4 — CID 91368033
methyl (2R)-2-amino-3-[4-[4-[(2-oxo-1H-indol-3-ylidene)methyl]-3-(trifluoromethyl)phenoxy]phenyl]propanoate (PubChem CID 91368033) has the molecular formula C26H21F3N2O4 and a molecular weight of 482.46 g/mol. Its IUPAC name is methyl (2R)-2-amino-3-[4-[4-[(2-oxo-1H-indol-3-ylidene)methyl]-3-(trifluoromethyl)phenoxy]phenyl]propanoate.
| Compound Name | methyl (2R)-2-amino-3-[4-[4-[(2-oxo-1H-indol-3-ylidene)methyl]-3-(trifluoromethyl)phenoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 91368033 |
| Molecular Formula | C26H21F3N2O4 |
| Molecular Weight | 482.46 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | methyl (2R)-2-amino-3-[4-[4-[(2-oxo-1H-indol-3-ylidene)methyl]-3-(trifluoromethyl)phenoxy]phenyl]propanoate |
| SMILES | COC(=O)[C@H](N)Cc1ccc(Oc2ccc(C=C3C(=O)Nc4ccccc43)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C26H21F3N2O4/c1-34-25(33)22(30)12-15-6-9-17(10-7-15)35-18-11-8-16(21(14-18)26(27,28)29)13-20-19-4-2-3-5-23(19)31-24(20)32/h2-11,13-14,22H,12,30H2,1H3,(H,31,32)/t22-/m1/s1 |
| InChIKey | CKTGXRHOIABUNN-JOCHJYFZSA-N |
| XLogP | 5.03 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.46 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|