C20H15F3N2O6 — CID 67014816
2-amino-3-[4-[4-[(2,4-dioxo-1,3-oxazolidin-5-ylidene)methyl]-3-(trifluoromethyl)phenoxy]phenyl]propanoic acid (PubChem CID 67014816) has the molecular formula C20H15F3N2O6 and a molecular weight of 436.34 g/mol. Its IUPAC name is 2-amino-3-[4-[4-[(2,4-dioxo-1,3-oxazolidin-5-ylidene)methyl]-3-(trifluoromethyl)phenoxy]phenyl]propanoic acid.
| Compound Name | 2-amino-3-[4-[4-[(2,4-dioxo-1,3-oxazolidin-5-ylidene)methyl]-3-(trifluoromethyl)phenoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 67014816 |
| Molecular Formula | C20H15F3N2O6 |
| Molecular Weight | 436.34 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | 2-amino-3-[4-[4-[(2,4-dioxo-1,3-oxazolidin-5-ylidene)methyl]-3-(trifluoromethyl)phenoxy]phenyl]propanoic acid |
| SMILES | NC(Cc1ccc(Oc2ccc(C=C3OC(=O)NC3=O)c(C(F)(F)F)c2)cc1)C(=O)O |
| InChI | InChI=1S/C20H15F3N2O6/c21-20(22,23)14-9-13(6-3-11(14)8-16-17(26)25-19(29)31-16)30-12-4-1-10(2-5-12)7-15(24)18(27)28/h1-6,8-9,15H,7,24H2,(H,27,28)(H,25,26,29) |
| InChIKey | JYYLIYMBAQWOHZ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.34 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|