C20H16F2N2O6 — CID 10364693
methyl 2-amino-3-[4-[4-[(Z)-(2,4-dioxo-1,3-oxazolidin-5-ylidene)methyl]-3,5-difluorophenoxy]phenyl]propanoate (PubChem CID 10364693) has the molecular formula C20H16F2N2O6 and a molecular weight of 418.35 g/mol. Its IUPAC name is methyl 2-amino-3-[4-[4-[(Z)-(2,4-dioxo-1,3-oxazolidin-5-ylidene)methyl]-3,5-difluorophenoxy]phenyl]propanoate.
| Compound Name | methyl 2-amino-3-[4-[4-[(Z)-(2,4-dioxo-1,3-oxazolidin-5-ylidene)methyl]-3,5-difluorophenoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 10364693 |
| Molecular Formula | C20H16F2N2O6 |
| Molecular Weight | 418.35 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | methyl 2-amino-3-[4-[4-[(Z)-(2,4-dioxo-1,3-oxazolidin-5-ylidene)methyl]-3,5-difluorophenoxy]phenyl]propanoate |
| SMILES | COC(=O)C(N)Cc1ccc(Oc2cc(F)c(/C=C3\OC(=O)NC3=O)c(F)c2)cc1 |
| InChI | InChI=1S/C20H16F2N2O6/c1-28-19(26)16(23)6-10-2-4-11(5-3-10)29-12-7-14(21)13(15(22)8-12)9-17-18(25)24-20(27)30-17/h2-5,7-9,16H,6,23H2,1H3,(H,24,25,27)/b17-9- |
| InChIKey | JPSREXAVJGNSTI-MFOYZWKCSA-N |
| XLogP | 2.41 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|