C20H16F2N2O5S — CID 87236565
methyl 2-amino-3-[4-[4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-3,5-difluorophenyl]propanoate (PubChem CID 87236565) has the molecular formula C20H16F2N2O5S and a molecular weight of 434.42 g/mol. Its IUPAC name is methyl 2-amino-3-[4-[4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-3,5-difluorophenyl]propanoate.
| Compound Name | methyl 2-amino-3-[4-[4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-3,5-difluorophenyl]propanoate |
|---|---|
| PubChem CID | 87236565 |
| Molecular Formula | C20H16F2N2O5S |
| Molecular Weight | 434.42 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | methyl 2-amino-3-[4-[4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-3,5-difluorophenyl]propanoate |
| SMILES | COC(=O)C(N)Cc1cc(F)c(Oc2ccc(C=C3SC(=O)NC3=O)cc2)c(F)c1 |
| InChI | InChI=1S/C20H16F2N2O5S/c1-28-19(26)15(23)8-11-6-13(21)17(14(22)7-11)29-12-4-2-10(3-5-12)9-16-18(25)24-20(27)30-16/h2-7,9,15H,8,23H2,1H3,(H,24,25,27) |
| InChIKey | JIFOUHKXLHEKOI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|