C20H17FN2O5S — CID 22669012
methyl 2-amino-3-[4-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-fluorophenoxy]phenyl]propanoate (PubChem CID 22669012) has the molecular formula C20H17FN2O5S and a molecular weight of 416.43 g/mol. Its IUPAC name is methyl 2-amino-3-[4-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-fluorophenoxy]phenyl]propanoate.
| Compound Name | methyl 2-amino-3-[4-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-fluorophenoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 22669012 |
| Molecular Formula | C20H17FN2O5S |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | methyl 2-amino-3-[4-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-fluorophenoxy]phenyl]propanoate |
| SMILES | COC(=O)C(N)Cc1ccc(Oc2ccc(/C=C3\SC(=O)NC3=O)cc2F)cc1 |
| InChI | InChI=1S/C20H17FN2O5S/c1-27-19(25)15(22)9-11-2-5-13(6-3-11)28-16-7-4-12(8-14(16)21)10-17-18(24)23-20(26)29-17/h2-8,10,15H,9,22H2,1H3,(H,23,24,26)/b17-10- |
| InChIKey | IGONZXKWPXGJJN-YVLHZVERSA-N |
| XLogP | 2.98 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|