C24H22FN3O6S — CID 11167933
3-[4-[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-fluorophenoxy]phenyl]-2-(pyrrolidine-2-carbonylamino)propanoic acid (PubChem CID 11167933) has the molecular formula C24H22FN3O6S and a molecular weight of 499.52 g/mol. Its IUPAC name is 3-[4-[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-fluorophenoxy]phenyl]-2-(pyrrolidine-2-carbonylamino)propanoic acid.
| Compound Name | 3-[4-[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-fluorophenoxy]phenyl]-2-(pyrrolidine-2-carbonylamino)propanoic acid |
|---|---|
| PubChem CID | 11167933 |
| Molecular Formula | C24H22FN3O6S |
| Molecular Weight | 499.52 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | 3-[4-[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-fluorophenoxy]phenyl]-2-(pyrrolidine-2-carbonylamino)propanoic acid |
| SMILES | O=C1NC(=O)/C(=C\c2ccc(Oc3ccc(CC(NC(=O)C4CCCN4)C(=O)O)cc3)c(F)c2)S1 |
| InChI | InChI=1S/C24H22FN3O6S/c25-16-10-14(12-20-22(30)28-24(33)35-20)5-8-19(16)34-15-6-3-13(4-7-15)11-18(23(31)32)27-21(29)17-2-1-9-26-17/h3-8,10,12,17-18,26H,1-2,9,11H2,(H,27,29)(H,31,32)(H,28,30,33)/b20-12+ |
| InChIKey | YXVDNMFVHWUYST-UDWIEESQSA-N |
| XLogP | 2.81 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.52 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|