C26H34N2O7 — CID 146217461
(2S)-3-[4-[2,6-dimethoxy-4-(2-methoxyethoxymethyl)phenyl]phenyl]-2-[[(2S)-pyrrolidine-2-carbonyl]amino]propanoic acid (PubChem CID 146217461) has the molecular formula C26H34N2O7 and a molecular weight of 486.57 g/mol. Its IUPAC name is (2S)-3-[4-[2,6-dimethoxy-4-(2-methoxyethoxymethyl)phenyl]phenyl]-2-[[(2S)-pyrrolidine-2-carbonyl]amino]propanoic acid.
| Compound Name | (2S)-3-[4-[2,6-dimethoxy-4-(2-methoxyethoxymethyl)phenyl]phenyl]-2-[[(2S)-pyrrolidine-2-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 146217461 |
| Molecular Formula | C26H34N2O7 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | (2S)-3-[4-[2,6-dimethoxy-4-(2-methoxyethoxymethyl)phenyl]phenyl]-2-[[(2S)-pyrrolidine-2-carbonyl]amino]propanoic acid |
| SMILES | COCCOCc1cc(OC)c(-c2ccc(C[C@H](NC(=O)[C@@H]3CCCN3)C(=O)O)cc2)c(OC)c1 |
| InChI | InChI=1S/C26H34N2O7/c1-32-11-12-35-16-18-14-22(33-2)24(23(15-18)34-3)19-8-6-17(7-9-19)13-21(26(30)31)28-25(29)20-5-4-10-27-20/h6-9,14-15,20-21,27H,4-5,10-13,16H2,1-3H3,(H,28,29)(H,30,31)/t20-,21-/m0/s1 |
| InChIKey | WOKZDWXEKULZMX-SFTDATJTSA-N |
| XLogP | 2.40 |
| TPSA | 115.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|