C25H29Cl2NO6 — CID 143079599
(2S)-2-[(3,3-dichloro-2-methylprop-2-enoyl)amino]-3-[4-[2,6-dimethoxy-4-(propoxymethyl)phenyl]phenyl]propanoic acid (PubChem CID 143079599) has the molecular formula C25H29Cl2NO6 and a molecular weight of 510.41 g/mol. Its IUPAC name is (2S)-2-[(3,3-dichloro-2-methylprop-2-enoyl)amino]-3-[4-[2,6-dimethoxy-4-(propoxymethyl)phenyl]phenyl]propanoic acid.
| Compound Name | (2S)-2-[(3,3-dichloro-2-methylprop-2-enoyl)amino]-3-[4-[2,6-dimethoxy-4-(propoxymethyl)phenyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 143079599 |
| Molecular Formula | C25H29Cl2NO6 |
| Molecular Weight | 510.41 g/mol |
| Exact Mass | 509.14 |
| IUPAC Name | (2S)-2-[(3,3-dichloro-2-methylprop-2-enoyl)amino]-3-[4-[2,6-dimethoxy-4-(propoxymethyl)phenyl]phenyl]propanoic acid |
| SMILES | CCCOCc1cc(OC)c(-c2ccc(C[C@H](NC(=O)C(C)=C(Cl)Cl)C(=O)O)cc2)c(OC)c1 |
| InChI | InChI=1S/C25H29Cl2NO6/c1-5-10-34-14-17-12-20(32-3)22(21(13-17)33-4)18-8-6-16(7-9-18)11-19(25(30)31)28-24(29)15(2)23(26)27/h6-9,12-13,19H,5,10-11,14H2,1-4H3,(H,28,29)(H,30,31)/t19-/m0/s1 |
| InChIKey | ACNYQJQDFFQVJI-IBGZPJMESA-N |
| XLogP | 5.12 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.41 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|