C30H33Cl2NO6 — CID 66843415
ethyl (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-[2,6-dimethoxy-4-(propoxymethyl)phenyl]phenyl]propanoate (PubChem CID 66843415) has the molecular formula C30H33Cl2NO6 and a molecular weight of 574.50 g/mol. Its IUPAC name is ethyl (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-[2,6-dimethoxy-4-(propoxymethyl)phenyl]phenyl]propanoate.
| Compound Name | ethyl (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-[2,6-dimethoxy-4-(propoxymethyl)phenyl]phenyl]propanoate |
|---|---|
| PubChem CID | 66843415 |
| Molecular Formula | C30H33Cl2NO6 |
| Molecular Weight | 574.50 g/mol |
| Exact Mass | 573.17 |
| IUPAC Name | ethyl (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-[2,6-dimethoxy-4-(propoxymethyl)phenyl]phenyl]propanoate |
| SMILES | CCCOCc1cc(OC)c(-c2ccc(C[C@H](NC(=O)c3c(Cl)cccc3Cl)C(=O)OCC)cc2)c(OC)c1 |
| InChI | InChI=1S/C30H33Cl2NO6/c1-5-14-38-18-20-16-25(36-3)27(26(17-20)37-4)21-12-10-19(11-13-21)15-24(30(35)39-6-2)33-29(34)28-22(31)8-7-9-23(28)32/h7-13,16-17,24H,5-6,14-15,18H2,1-4H3,(H,33,34)/t24-/m0/s1 |
| InChIKey | BXMLJHLZFMQUNZ-DEOSSOPVSA-N |
| XLogP | 6.51 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.50 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|