C17H23N3O4S — CID 18223658
2-[[3-phenyl-2-(pyrrolidine-2-carbonylamino)propanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 18223658) has the molecular formula C17H23N3O4S and a molecular weight of 365.46 g/mol. Its IUPAC name is 2-[[3-phenyl-2-(pyrrolidine-2-carbonylamino)propanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[[3-phenyl-2-(pyrrolidine-2-carbonylamino)propanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 18223658 |
| Molecular Formula | C17H23N3O4S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 2-[[3-phenyl-2-(pyrrolidine-2-carbonylamino)propanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | O=C(O)C(CS)NC(=O)C(Cc1ccccc1)NC(=O)C1CCCN1 |
| InChI | InChI=1S/C17H23N3O4S/c21-15(12-7-4-8-18-12)19-13(9-11-5-2-1-3-6-11)16(22)20-14(10-25)17(23)24/h1-3,5-6,12-14,18,25H,4,7-10H2,(H,19,21)(H,20,22)(H,23,24) |
| InChIKey | DYMPSOABVJIFBS-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|