C32H53N7O6 — CID 175731187
(2S)-2-[[(2S)-6-amino-2-[[(2S)-2-[[(2S)-6-amino-2-[[(2S)-pyrrolidine-2-carbonyl]amino]hexanoyl]amino]-3-phenylpropanoyl]amino]hexanoyl]amino]-4-methylpentanoic acid (PubChem CID 175731187) has the molecular formula C32H53N7O6 and a molecular weight of 631.82 g/mol. Its IUPAC name is (2S)-2-[[(2S)-6-amino-2-[[(2S)-2-[[(2S)-6-amino-2-[[(2S)-pyrrolidine-2-carbonyl]amino]hexanoyl]amino]-3-phenylpropanoyl]amino]hexanoyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[(2S)-6-amino-2-[[(2S)-2-[[(2S)-6-amino-2-[[(2S)-pyrrolidine-2-carbonyl]amino]hexanoyl]amino]-3-phenylpropanoyl]amino]hexanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 175731187 |
| Molecular Formula | C32H53N7O6 |
| Molecular Weight | 631.82 g/mol |
| Exact Mass | 631.41 |
| IUPAC Name | (2S)-2-[[(2S)-6-amino-2-[[(2S)-2-[[(2S)-6-amino-2-[[(2S)-pyrrolidine-2-carbonyl]amino]hexanoyl]amino]-3-phenylpropanoyl]amino]hexanoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](CCCCN)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCCCN)NC(=O)[C@@H]1CCCN1)C(=O)O |
| InChI | InChI=1S/C32H53N7O6/c1-21(2)19-27(32(44)45)39-30(42)25(14-7-9-17-34)37-31(43)26(20-22-11-4-3-5-12-22)38-29(41)24(13-6-8-16-33)36-28(40)23-15-10-18-35-23/h3-5,11-12,21,23-27,35H,6-10,13-20,33-34H2,1-2H3,(H,36,40)(H,37,43)(H,38,41)(H,39,42)(H,44,45)/t23-,24-,25-,26-,27-/m0/s1 |
| InChIKey | BOJCOGFLKMUERR-IRGGMKSGSA-N |
| XLogP | 0.31 |
| TPSA | 217.77 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.82 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|