C17H33N5O4 — CID 67743849
(2S)-6-amino-2-[[(2S)-6-amino-2-(pyrrolidine-2-carbonylamino)hexanoyl]amino]hexanoic acid (PubChem CID 67743849) has the molecular formula C17H33N5O4 and a molecular weight of 371.48 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2S)-6-amino-2-(pyrrolidine-2-carbonylamino)hexanoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(2S)-6-amino-2-(pyrrolidine-2-carbonylamino)hexanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 67743849 |
| Molecular Formula | C17H33N5O4 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | (2S)-6-amino-2-[[(2S)-6-amino-2-(pyrrolidine-2-carbonylamino)hexanoyl]amino]hexanoic acid |
| SMILES | NCCCC[C@H](NC(=O)[C@H](CCCCN)NC(=O)C1CCCN1)C(=O)O |
| InChI | InChI=1S/C17H33N5O4/c18-9-3-1-6-13(21-15(23)12-8-5-11-20-12)16(24)22-14(17(25)26)7-2-4-10-19/h12-14,20H,1-11,18-19H2,(H,21,23)(H,22,24)(H,25,26)/t12?,13-,14-/m0/s1 |
| InChIKey | DWGFLKQSGRUQTI-TTZKSVMKSA-N |
| XLogP | -0.95 |
| TPSA | 159.57 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|