C15H26N4O6 — CID 145457418
(2S)-6-amino-2-[[(2S)-3-carboxy-2-[[(2S)-pyrrolidine-2-carbonyl]amino]propanoyl]amino]hexanoic acid (PubChem CID 145457418) has the molecular formula C15H26N4O6 and a molecular weight of 358.40 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2S)-3-carboxy-2-[[(2S)-pyrrolidine-2-carbonyl]amino]propanoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(2S)-3-carboxy-2-[[(2S)-pyrrolidine-2-carbonyl]amino]propanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 145457418 |
| Molecular Formula | C15H26N4O6 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | (2S)-6-amino-2-[[(2S)-3-carboxy-2-[[(2S)-pyrrolidine-2-carbonyl]amino]propanoyl]amino]hexanoic acid |
| SMILES | NCCCC[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H]1CCCN1)C(=O)O |
| InChI | InChI=1S/C15H26N4O6/c16-6-2-1-4-10(15(24)25)18-14(23)11(8-12(20)21)19-13(22)9-5-3-7-17-9/h9-11,17H,1-8,16H2,(H,18,23)(H,19,22)(H,20,21)(H,24,25)/t9-,10-,11-/m0/s1 |
| InChIKey | XKHCJJPNXFBADI-DCAQKATOSA-N |
| XLogP | -1.60 |
| TPSA | 170.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|