C13H20N4O7 — CID 18223476
4-amino-2-[[3-carboxy-2-(pyrrolidine-2-carbonylamino)propanoyl]amino]-4-oxobutanoic acid (PubChem CID 18223476) has the molecular formula C13H20N4O7 and a molecular weight of 344.32 g/mol. Its IUPAC name is 4-amino-2-[[3-carboxy-2-(pyrrolidine-2-carbonylamino)propanoyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[[3-carboxy-2-(pyrrolidine-2-carbonylamino)propanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18223476 |
| Molecular Formula | C13H20N4O7 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 4-amino-2-[[3-carboxy-2-(pyrrolidine-2-carbonylamino)propanoyl]amino]-4-oxobutanoic acid |
| SMILES | NC(=O)CC(NC(=O)C(CC(=O)O)NC(=O)C1CCCN1)C(=O)O |
| InChI | InChI=1S/C13H20N4O7/c14-9(18)4-8(13(23)24)17-12(22)7(5-10(19)20)16-11(21)6-2-1-3-15-6/h6-8,15H,1-5H2,(H2,14,18)(H,16,21)(H,17,22)(H,19,20)(H,23,24) |
| InChIKey | CJZTUKSFZUSNCC-UHFFFAOYSA-N |
| XLogP | -2.86 |
| TPSA | 187.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | -2.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |