C21H39N9O6 — CID 10142432
(2S)-6-amino-2-[[(2S)-4-amino-2-[[(2S)-5-(diaminomethylideneamino)-2-[[(2S)-pyrrolidine-2-carbonyl]amino]pentanoyl]amino]-4-oxobutanoyl]amino]hexanoic acid (PubChem CID 10142432) has the molecular formula C21H39N9O6 and a molecular weight of 513.60 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2S)-4-amino-2-[[(2S)-5-(diaminomethylideneamino)-2-[[(2S)-pyrrolidine-2-carbonyl]amino]pentanoyl]amino]-4-oxobutanoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(2S)-4-amino-2-[[(2S)-5-(diaminomethylideneamino)-2-[[(2S)-pyrrolidine-2-carbonyl]amino]pentanoyl]amino]-4-oxobutanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 10142432 |
| Molecular Formula | C21H39N9O6 |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 513.30 |
| IUPAC Name | (2S)-6-amino-2-[[(2S)-4-amino-2-[[(2S)-5-(diaminomethylideneamino)-2-[[(2S)-pyrrolidine-2-carbonyl]amino]pentanoyl]amino]-4-oxobutanoyl]amino]hexanoic acid |
| SMILES | NCCCC[C@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H]1CCCN1)C(=O)O |
| InChI | InChI=1S/C21H39N9O6/c22-8-2-1-5-14(20(35)36)29-19(34)15(11-16(23)31)30-18(33)13(7-4-10-27-21(24)25)28-17(32)12-6-3-9-26-12/h12-15,26H,1-11,22H2,(H2,23,31)(H,28,32)(H,29,34)(H,30,33)(H,35,36)(H4,24,25,27)/t12-,13-,14-,15-/m0/s1 |
| InChIKey | YQGNHBCMKHMCOQ-AJNGGQMLSA-N |
| XLogP | -3.66 |
| TPSA | 270.14 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | -3.66 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|