C17H34BrN5O4 — CID 67743850
(2S)-6-amino-2-[[(2S)-6-amino-2-[[(2S)-pyrrolidine-2-carbonyl]amino]hexanoyl]amino]hexanoic acid;hydrobromide (PubChem CID 67743850) has the molecular formula C17H34BrN5O4 and a molecular weight of 452.39 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2S)-6-amino-2-[[(2S)-pyrrolidine-2-carbonyl]amino]hexanoyl]amino]hexanoic acid;hydrobromide.
| Compound Name | (2S)-6-amino-2-[[(2S)-6-amino-2-[[(2S)-pyrrolidine-2-carbonyl]amino]hexanoyl]amino]hexanoic acid;hydrobromide |
|---|---|
| PubChem CID | 67743850 |
| Molecular Formula | C17H34BrN5O4 |
| Molecular Weight | 452.39 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | (2S)-6-amino-2-[[(2S)-6-amino-2-[[(2S)-pyrrolidine-2-carbonyl]amino]hexanoyl]amino]hexanoic acid;hydrobromide |
| SMILES | Br.NCCCC[C@H](NC(=O)[C@H](CCCCN)NC(=O)[C@@H]1CCCN1)C(=O)O |
| InChI | InChI=1S/C17H33N5O4.BrH/c18-9-3-1-6-13(21-15(23)12-8-5-11-20-12)16(24)22-14(17(25)26)7-2-4-10-19;/h12-14,20H,1-11,18-19H2,(H,21,23)(H,22,24)(H,25,26);1H/t12-,13-,14-;/m0./s1 |
| InChIKey | GEIICSVSHGMADR-JKBZPBJLSA-N |
| XLogP | -0.37 |
| TPSA | 159.57 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.39 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|