C17H28CuN6O4 — CID 67545897
6-amino-2-[[3-(1H-imidazol-5-yl)-2-(pyrrolidine-2-carbonylamino)propanoyl]amino]hexanoic acid;copper (PubChem CID 67545897) has the molecular formula C17H28CuN6O4 and a molecular weight of 444.00 g/mol. Its IUPAC name is 6-amino-2-[[3-(1H-imidazol-5-yl)-2-(pyrrolidine-2-carbonylamino)propanoyl]amino]hexanoic acid;copper.
| Compound Name | 6-amino-2-[[3-(1H-imidazol-5-yl)-2-(pyrrolidine-2-carbonylamino)propanoyl]amino]hexanoic acid;copper |
|---|---|
| PubChem CID | 67545897 |
| Molecular Formula | C17H28CuN6O4 |
| Molecular Weight | 444.00 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 6-amino-2-[[3-(1H-imidazol-5-yl)-2-(pyrrolidine-2-carbonylamino)propanoyl]amino]hexanoic acid;copper |
| SMILES | NCCCCC(NC(=O)C(Cc1cnc[nH]1)NC(=O)C1CCCN1)C(=O)O.[Cu] |
| InChI | InChI=1S/C17H28N6O4.Cu/c18-6-2-1-4-13(17(26)27)22-16(25)14(8-11-9-19-10-21-11)23-15(24)12-5-3-7-20-12;/h9-10,12-14,20H,1-8,18H2,(H,19,21)(H,22,25)(H,23,24)(H,26,27); |
| InChIKey | NIWQFNNLFUNSEP-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 162.23 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.00 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|