C14H21N5O4S — CID 18223502
3-(1H-imidazol-5-yl)-2-[[2-(pyrrolidine-2-carbonylamino)-3-sulfanylpropanoyl]amino]propanoic acid (PubChem CID 18223502) has the molecular formula C14H21N5O4S and a molecular weight of 355.42 g/mol. Its IUPAC name is 3-(1H-imidazol-5-yl)-2-[[2-(pyrrolidine-2-carbonylamino)-3-sulfanylpropanoyl]amino]propanoic acid.
| Compound Name | 3-(1H-imidazol-5-yl)-2-[[2-(pyrrolidine-2-carbonylamino)-3-sulfanylpropanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 18223502 |
| Molecular Formula | C14H21N5O4S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 3-(1H-imidazol-5-yl)-2-[[2-(pyrrolidine-2-carbonylamino)-3-sulfanylpropanoyl]amino]propanoic acid |
| SMILES | O=C(O)C(Cc1cnc[nH]1)NC(=O)C(CS)NC(=O)C1CCCN1 |
| InChI | InChI=1S/C14H21N5O4S/c20-12(9-2-1-3-16-9)19-11(6-24)13(21)18-10(14(22)23)4-8-5-15-7-17-8/h5,7,9-11,16,24H,1-4,6H2,(H,15,17)(H,18,21)(H,19,20)(H,22,23) |
| InChIKey | OGRYXQOUFHAMPI-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 136.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|