C12H19N3O6S — CID 18223497
2-[[2-(pyrrolidine-2-carbonylamino)-3-sulfanylpropanoyl]amino]butanedioic acid (PubChem CID 18223497) has the molecular formula C12H19N3O6S and a molecular weight of 333.37 g/mol. Its IUPAC name is 2-[[2-(pyrrolidine-2-carbonylamino)-3-sulfanylpropanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-(pyrrolidine-2-carbonylamino)-3-sulfanylpropanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18223497 |
| Molecular Formula | C12H19N3O6S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 2-[[2-(pyrrolidine-2-carbonylamino)-3-sulfanylpropanoyl]amino]butanedioic acid |
| SMILES | O=C(O)CC(NC(=O)C(CS)NC(=O)C1CCCN1)C(=O)O |
| InChI | InChI=1S/C12H19N3O6S/c16-9(17)4-7(12(20)21)14-11(19)8(5-22)15-10(18)6-2-1-3-13-6/h6-8,13,22H,1-5H2,(H,14,19)(H,15,18)(H,16,17)(H,20,21) |
| InChIKey | QXNSKJLSLYCTMT-UHFFFAOYSA-N |
| XLogP | -1.80 |
| TPSA | 144.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|