C14H26N4O4S — CID 145457434
(2S)-6-amino-2-[[(2R)-2-[[(2S)-pyrrolidine-2-carbonyl]amino]-3-sulfanylpropanoyl]amino]hexanoic acid (PubChem CID 145457434) has the molecular formula C14H26N4O4S and a molecular weight of 346.45 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2R)-2-[[(2S)-pyrrolidine-2-carbonyl]amino]-3-sulfanylpropanoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(2R)-2-[[(2S)-pyrrolidine-2-carbonyl]amino]-3-sulfanylpropanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 145457434 |
| Molecular Formula | C14H26N4O4S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | (2S)-6-amino-2-[[(2R)-2-[[(2S)-pyrrolidine-2-carbonyl]amino]-3-sulfanylpropanoyl]amino]hexanoic acid |
| SMILES | NCCCC[C@H](NC(=O)[C@H](CS)NC(=O)[C@@H]1CCCN1)C(=O)O |
| InChI | InChI=1S/C14H26N4O4S/c15-6-2-1-4-10(14(21)22)17-13(20)11(8-23)18-12(19)9-5-3-7-16-9/h9-11,16,23H,1-8,15H2,(H,17,20)(H,18,19)(H,21,22)/t9-,10-,11-/m0/s1 |
| InChIKey | OLTFZQIYCNOBLI-DCAQKATOSA-N |
| XLogP | -1.15 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|