C12H19N3O7 — CID 18223690
2-[[3-hydroxy-2-(pyrrolidine-2-carbonylamino)propanoyl]amino]butanedioic acid (PubChem CID 18223690) has the molecular formula C12H19N3O7 and a molecular weight of 317.30 g/mol. Its IUPAC name is 2-[[3-hydroxy-2-(pyrrolidine-2-carbonylamino)propanoyl]amino]butanedioic acid.
| Compound Name | 2-[[3-hydroxy-2-(pyrrolidine-2-carbonylamino)propanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18223690 |
| Molecular Formula | C12H19N3O7 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 2-[[3-hydroxy-2-(pyrrolidine-2-carbonylamino)propanoyl]amino]butanedioic acid |
| SMILES | O=C(O)CC(NC(=O)C(CO)NC(=O)C1CCCN1)C(=O)O |
| InChI | InChI=1S/C12H19N3O7/c16-5-8(15-10(19)6-2-1-3-13-6)11(20)14-7(12(21)22)4-9(17)18/h6-8,13,16H,1-5H2,(H,14,20)(H,15,19)(H,17,18)(H,21,22) |
| InChIKey | GMJDSFYVTAMIBF-UHFFFAOYSA-N |
| XLogP | -2.74 |
| TPSA | 165.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | -2.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |