C8H14N2O4 — CID 80751621
(2R)-3-hydroxy-2-(pyrrolidine-2-carbonylamino)propanoic acid (PubChem CID 80751621) has the molecular formula C8H14N2O4 and a molecular weight of 202.21 g/mol. Its IUPAC name is (2R)-3-hydroxy-2-(pyrrolidine-2-carbonylamino)propanoic acid.
| Compound Name | (2R)-3-hydroxy-2-(pyrrolidine-2-carbonylamino)propanoic acid |
|---|---|
| PubChem CID | 80751621 |
| Molecular Formula | C8H14N2O4 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | (2R)-3-hydroxy-2-(pyrrolidine-2-carbonylamino)propanoic acid |
| SMILES | O=C(N[C@H](CO)C(=O)O)C1CCCN1 |
| InChI | InChI=1S/C8H14N2O4/c11-4-6(8(13)14)10-7(12)5-2-1-3-9-5/h5-6,9,11H,1-4H2,(H,10,12)(H,13,14)/t5?,6-/m1/s1 |
| InChIKey | AFWBWPCXSWUCLB-PRJDIBJQSA-N |
| XLogP | -1.70 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |