C9H16N2O4 — CID 104901043
4-hydroxy-2-[[(2R)-pyrrolidine-2-carbonyl]amino]butanoic acid (PubChem CID 104901043) has the molecular formula C9H16N2O4 and a molecular weight of 216.24 g/mol. Its IUPAC name is 4-hydroxy-2-[[(2R)-pyrrolidine-2-carbonyl]amino]butanoic acid.
| Compound Name | 4-hydroxy-2-[[(2R)-pyrrolidine-2-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 104901043 |
| Molecular Formula | C9H16N2O4 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 4-hydroxy-2-[[(2R)-pyrrolidine-2-carbonyl]amino]butanoic acid |
| SMILES | O=C(O)C(CCO)NC(=O)[C@H]1CCCN1 |
| InChI | InChI=1S/C9H16N2O4/c12-5-3-7(9(14)15)11-8(13)6-2-1-4-10-6/h6-7,10,12H,1-5H2,(H,11,13)(H,14,15)/t6-,7?/m1/s1 |
| InChIKey | LRYHISKVHNZFAP-ULUSZKPHSA-N |
| XLogP | -1.31 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |