C10H17N3O4S — CID 51037953
2-[[(2R)-2-[[(2S)-pyrrolidine-2-carbonyl]amino]-3-sulfanylpropanoyl]amino]acetic acid (PubChem CID 51037953) has the molecular formula C10H17N3O4S and a molecular weight of 275.33 g/mol. Its IUPAC name is 2-[[(2R)-2-[[(2S)-pyrrolidine-2-carbonyl]amino]-3-sulfanylpropanoyl]amino]acetic acid.
| Compound Name | 2-[[(2R)-2-[[(2S)-pyrrolidine-2-carbonyl]amino]-3-sulfanylpropanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 51037953 |
| Molecular Formula | C10H17N3O4S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 2-[[(2R)-2-[[(2S)-pyrrolidine-2-carbonyl]amino]-3-sulfanylpropanoyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)[C@H](CS)NC(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C10H17N3O4S/c14-8(15)4-12-9(16)7(5-18)13-10(17)6-2-1-3-11-6/h6-7,11,18H,1-5H2,(H,12,16)(H,13,17)(H,14,15)/t6-,7-/m0/s1 |
| InChIKey | SZZBUDVXWZZPDH-BQBZGAKWSA-N |
| XLogP | -1.65 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|