C13H24N6O4 — CID 18223443
2-[[5-(diaminomethylideneamino)-2-(pyrrolidine-2-carbonylamino)pentanoyl]amino]acetic acid (PubChem CID 18223443) has the molecular formula C13H24N6O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is 2-[[5-(diaminomethylideneamino)-2-(pyrrolidine-2-carbonylamino)pentanoyl]amino]acetic acid.
| Compound Name | 2-[[5-(diaminomethylideneamino)-2-(pyrrolidine-2-carbonylamino)pentanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 18223443 |
| Molecular Formula | C13H24N6O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 2-[[5-(diaminomethylideneamino)-2-(pyrrolidine-2-carbonylamino)pentanoyl]amino]acetic acid |
| SMILES | NC(N)=NCCCC(NC(=O)C1CCCN1)C(=O)NCC(=O)O |
| InChI | InChI=1S/C13H24N6O4/c14-13(15)17-6-2-4-9(11(22)18-7-10(20)21)19-12(23)8-3-1-5-16-8/h8-9,16H,1-7H2,(H,18,22)(H,19,23)(H,20,21)(H4,14,15,17) |
| InChIKey | BNBBNGZZKQUWCD-UHFFFAOYSA-N |
| XLogP | -2.52 |
| TPSA | 171.93 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | -2.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|