C15H27N7O5 — CID 175735485
2-[[2-[[(2S)-5-(diaminomethylideneamino)-2-[[(2S)-pyrrolidine-2-carbonyl]amino]pentanoyl]amino]acetyl]amino]acetic acid (PubChem CID 175735485) has the molecular formula C15H27N7O5 and a molecular weight of 385.43 g/mol. Its IUPAC name is 2-[[2-[[(2S)-5-(diaminomethylideneamino)-2-[[(2S)-pyrrolidine-2-carbonyl]amino]pentanoyl]amino]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[[(2S)-5-(diaminomethylideneamino)-2-[[(2S)-pyrrolidine-2-carbonyl]amino]pentanoyl]amino]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 175735485 |
| Molecular Formula | C15H27N7O5 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | 2-[[2-[[(2S)-5-(diaminomethylideneamino)-2-[[(2S)-pyrrolidine-2-carbonyl]amino]pentanoyl]amino]acetyl]amino]acetic acid |
| SMILES | NC(N)=NCCC[C@H](NC(=O)[C@@H]1CCCN1)C(=O)NCC(=O)NCC(=O)O |
| InChI | InChI=1S/C15H27N7O5/c16-15(17)19-6-2-4-10(22-14(27)9-3-1-5-18-9)13(26)21-7-11(23)20-8-12(24)25/h9-10,18H,1-8H2,(H,20,23)(H,21,26)(H,22,27)(H,24,25)(H4,16,17,19)/t9-,10-/m0/s1 |
| InChIKey | DBQPZOPIEUSGHY-UWVGGRQHSA-N |
| XLogP | -3.41 |
| TPSA | 201.03 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | -3.41 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|