C24H35N9O4 — CID 69256578
(2S)-N-[(2R)-1-[[2-[[(2S)-1-amino-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-2-oxoethyl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]pyrrolidine-2-carboxamide (PubChem CID 69256578) has the molecular formula C24H35N9O4 and a molecular weight of 513.60 g/mol. Its IUPAC name is (2S)-N-[(2R)-1-[[2-[[(2S)-1-amino-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-2-oxoethyl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(2R)-1-[[2-[[(2S)-1-amino-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-2-oxoethyl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 69256578 |
| Molecular Formula | C24H35N9O4 |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 513.28 |
| IUPAC Name | (2S)-N-[(2R)-1-[[2-[[(2S)-1-amino-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-2-oxoethyl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]pyrrolidine-2-carboxamide |
| SMILES | NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)CNC(=O)[C@@H](CCCN=C(N)N)NC(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C24H35N9O4/c25-21(35)19(11-14-12-30-16-6-2-1-5-15(14)16)32-20(34)13-31-22(36)18(8-4-10-29-24(26)27)33-23(37)17-7-3-9-28-17/h1-2,5-6,12,17-19,28,30H,3-4,7-11,13H2,(H2,25,35)(H,31,36)(H,32,34)(H,33,37)(H4,26,27,29)/t17-,18+,19-/m0/s1 |
| InChIKey | DANVCYHDUMZJCZ-OTWHNJEPSA-N |
| XLogP | -1.91 |
| TPSA | 222.61 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|