C14H26N6O5 — CID 145457566
(2S)-5-(diaminomethylideneamino)-2-[[(2S)-3-hydroxy-2-[[(2S)-pyrrolidine-2-carbonyl]amino]propanoyl]amino]pentanoic acid (PubChem CID 145457566) has the molecular formula C14H26N6O5 and a molecular weight of 358.40 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[[(2S)-3-hydroxy-2-[[(2S)-pyrrolidine-2-carbonyl]amino]propanoyl]amino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[[(2S)-3-hydroxy-2-[[(2S)-pyrrolidine-2-carbonyl]amino]propanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 145457566 |
| Molecular Formula | C14H26N6O5 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[[(2S)-3-hydroxy-2-[[(2S)-pyrrolidine-2-carbonyl]amino]propanoyl]amino]pentanoic acid |
| SMILES | NC(N)=NCCC[C@H](NC(=O)[C@H](CO)NC(=O)[C@@H]1CCCN1)C(=O)O |
| InChI | InChI=1S/C14H26N6O5/c15-14(16)18-6-2-4-9(13(24)25)19-12(23)10(7-21)20-11(22)8-3-1-5-17-8/h8-10,17,21H,1-7H2,(H,19,23)(H,20,22)(H,24,25)(H4,15,16,18)/t8-,9-,10-/m0/s1 |
| InChIKey | GOMUXSCOIWIJFP-GUBZILKMSA-N |
| XLogP | -3.16 |
| TPSA | 192.16 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | -3.16 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|