C34H54CuN12O8 — CID 67545899
copper bis((2S)-6-amino-2-[[(2S)-3-(1H-imidazol-5-yl)-2-[[(2S)-pyrrolidine-2-carbonyl]amino]propanoyl]amino]hexanoate) (PubChem CID 67545899) has the molecular formula C34H54CuN12O8 and a molecular weight of 822.43 g/mol. Its IUPAC name is copper bis((2S)-6-amino-2-[[(2S)-3-(1H-imidazol-5-yl)-2-[[(2S)-pyrrolidine-2-carbonyl]amino]propanoyl]amino]hexanoate).
| Compound Name | copper bis((2S)-6-amino-2-[[(2S)-3-(1H-imidazol-5-yl)-2-[[(2S)-pyrrolidine-2-carbonyl]amino]propanoyl]amino]hexanoate) |
|---|---|
| PubChem CID | 67545899 |
| Molecular Formula | C34H54CuN12O8 |
| Molecular Weight | 822.43 g/mol |
| Exact Mass | 821.35 |
| IUPAC Name | copper bis((2S)-6-amino-2-[[(2S)-3-(1H-imidazol-5-yl)-2-[[(2S)-pyrrolidine-2-carbonyl]amino]propanoyl]amino]hexanoate) |
| SMILES | NCCCC[C@H](NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)[C@@H]1CCCN1)C(=O)[O-].NCCCC[C@H](NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)[C@@H]1CCCN1)C(=O)[O-].[Cu+2] |
| InChI | InChI=1S/2C17H28N6O4.Cu/c2*18-6-2-1-4-13(17(26)27)22-16(25)14(8-11-9-19-10-21-11)23-15(24)12-5-3-7-20-12;/h2*9-10,12-14,20H,1-8,18H2,(H,19,21)(H,22,25)(H,23,24)(H,26,27);/q;;+2/p-2/t2*12-,13-,14-;/m00./s1 |
| InChIKey | LRZLCRYJYFSEQL-DATPOZBVSA-L |
| XLogP | -4.90 |
| TPSA | 330.12 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.43 |
| LogP ≤ 5 | -4.90 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|