C21H21ClN2O6S — CID 87588110
methyl (2S)-2-amino-3-[4-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenoxy]phenyl]propanoate;hydrochloride (PubChem CID 87588110) has the molecular formula C21H21ClN2O6S and a molecular weight of 464.93 g/mol. Its IUPAC name is methyl (2S)-2-amino-3-[4-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenoxy]phenyl]propanoate;hydrochloride.
| Compound Name | methyl (2S)-2-amino-3-[4-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenoxy]phenyl]propanoate;hydrochloride |
|---|---|
| PubChem CID | 87588110 |
| Molecular Formula | C21H21ClN2O6S |
| Molecular Weight | 464.93 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | methyl (2S)-2-amino-3-[4-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenoxy]phenyl]propanoate;hydrochloride |
| SMILES | COC(=O)[C@@H](N)Cc1ccc(Oc2ccc(/C=C3\SC(=O)NC3=O)cc2OC)cc1.Cl |
| InChI | InChI=1S/C21H20N2O6S.ClH/c1-27-17-10-13(11-18-19(24)23-21(26)30-18)5-8-16(17)29-14-6-3-12(4-7-14)9-15(22)20(25)28-2;/h3-8,10-11,15H,9,22H2,1-2H3,(H,23,24,26);1H/b18-11-;/t15-;/m0./s1 |
| InChIKey | MQCWRJBBLASLLK-CBOSGETHSA-N |
| XLogP | 3.28 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.93 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|