C19H11N3O4S — CID 51051232
4-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenoxy]benzene-1,2-dicarbonitrile (PubChem CID 51051232) has the molecular formula C19H11N3O4S and a molecular weight of 377.38 g/mol. Its IUPAC name is 4-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenoxy]benzene-1,2-dicarbonitrile.
| Compound Name | 4-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenoxy]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 51051232 |
| Molecular Formula | C19H11N3O4S |
| Molecular Weight | 377.38 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | 4-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenoxy]benzene-1,2-dicarbonitrile |
| SMILES | COc1cc(/C=C2\SC(=O)NC2=O)ccc1Oc1ccc(C#N)c(C#N)c1 |
| InChI | InChI=1S/C19H11N3O4S/c1-25-16-6-11(7-17-18(23)22-19(24)27-17)2-5-15(16)26-14-4-3-12(9-20)13(8-14)10-21/h2-8H,1H3,(H,22,23,24)/b17-7- |
| InChIKey | HRGNUULTOYCKKF-IDUWFGFVSA-N |
| XLogP | 3.55 |
| TPSA | 112.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|