C16H10N2O3 — CID 16762075
4-(4-formyl-2-methoxyphenoxy)benzene-1,2-dicarbonitrile (PubChem CID 16762075) has the molecular formula C16H10N2O3 and a molecular weight of 278.27 g/mol. Its IUPAC name is 4-(4-formyl-2-methoxyphenoxy)benzene-1,2-dicarbonitrile.
| Compound Name | 4-(4-formyl-2-methoxyphenoxy)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 16762075 |
| Molecular Formula | C16H10N2O3 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 4-(4-formyl-2-methoxyphenoxy)benzene-1,2-dicarbonitrile |
| SMILES | COc1cc(C=O)ccc1Oc1ccc(C#N)c(C#N)c1 |
| InChI | InChI=1S/C16H10N2O3/c1-20-16-6-11(10-19)2-5-15(16)21-14-4-3-12(8-17)13(7-14)9-18/h2-7,10H,1H3 |
| InChIKey | VJMLEJMWXLPTSA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 83.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|