C14H6F3NO2 — CID 86724189
5-formyl-2-(3,4,5-trifluorophenoxy)benzonitrile (PubChem CID 86724189) has the molecular formula C14H6F3NO2 and a molecular weight of 277.20 g/mol. Its IUPAC name is 5-formyl-2-(3,4,5-trifluorophenoxy)benzonitrile.
| Compound Name | 5-formyl-2-(3,4,5-trifluorophenoxy)benzonitrile |
|---|---|
| PubChem CID | 86724189 |
| Molecular Formula | C14H6F3NO2 |
| Molecular Weight | 277.20 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 5-formyl-2-(3,4,5-trifluorophenoxy)benzonitrile |
| SMILES | N#Cc1cc(C=O)ccc1Oc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C14H6F3NO2/c15-11-4-10(5-12(16)14(11)17)20-13-2-1-8(7-19)3-9(13)6-18/h1-5,7H |
| InChIKey | DVDKSROHCSFBHM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.20 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|