C9H3FN2O — CID 154726103
2-fluoro-5-formylbenzene-1,3-dicarbonitrile (PubChem CID 154726103) has the molecular formula C9H3FN2O and a molecular weight of 174.13 g/mol. Its IUPAC name is 2-fluoro-5-formylbenzene-1,3-dicarbonitrile.
| Compound Name | 2-fluoro-5-formylbenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 154726103 |
| Molecular Formula | C9H3FN2O |
| Molecular Weight | 174.13 g/mol |
| Exact Mass | 174.02 |
| IUPAC Name | 2-fluoro-5-formylbenzene-1,3-dicarbonitrile |
| SMILES | N#Cc1cc(C=O)cc(C#N)c1F |
| InChI | InChI=1S/C9H3FN2O/c10-9-7(3-11)1-6(5-13)2-8(9)4-12/h1-2,5H |
| InChIKey | XVIDWVXKCGOQTE-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 64.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.13 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|