C10H3F6NO — CID 134638670
5-formyl-2,3-bis(trifluoromethyl)benzonitrile (PubChem CID 134638670) has the molecular formula C10H3F6NO and a molecular weight of 267.13 g/mol. Its IUPAC name is 5-formyl-2,3-bis(trifluoromethyl)benzonitrile.
| Compound Name | 5-formyl-2,3-bis(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 134638670 |
| Molecular Formula | C10H3F6NO |
| Molecular Weight | 267.13 g/mol |
| Exact Mass | 267.01 |
| IUPAC Name | 5-formyl-2,3-bis(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1cc(C=O)cc(C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C10H3F6NO/c11-9(12,13)7-2-5(4-18)1-6(3-17)8(7)10(14,15)16/h1-2,4H |
| InChIKey | WELLBICVDQFKBI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.13 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|