C9H3ClF6O3S — CID 134638621
5-formyl-2,3-bis(trifluoromethyl)benzenesulfonyl chloride (PubChem CID 134638621) has the molecular formula C9H3ClF6O3S and a molecular weight of 340.63 g/mol. Its IUPAC name is 5-formyl-2,3-bis(trifluoromethyl)benzenesulfonyl chloride.
| Compound Name | 5-formyl-2,3-bis(trifluoromethyl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 134638621 |
| Molecular Formula | C9H3ClF6O3S |
| Molecular Weight | 340.63 g/mol |
| Exact Mass | 339.94 |
| IUPAC Name | 5-formyl-2,3-bis(trifluoromethyl)benzenesulfonyl chloride |
| SMILES | O=Cc1cc(C(F)(F)F)c(C(F)(F)F)c(S(=O)(=O)Cl)c1 |
| InChI | InChI=1S/C9H3ClF6O3S/c10-20(18,19)6-2-4(3-17)1-5(8(11,12)13)7(6)9(14,15)16/h1-3H |
| InChIKey | GGIVRRRBIRLDKD-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.63 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|