C9H3ClF6O — CID 118990875
4-chloro-2,6-bis(trifluoromethyl)benzaldehyde (PubChem CID 118990875) has the molecular formula C9H3ClF6O and a molecular weight of 276.56 g/mol. Its IUPAC name is 4-chloro-2,6-bis(trifluoromethyl)benzaldehyde.
| Compound Name | 4-chloro-2,6-bis(trifluoromethyl)benzaldehyde |
|---|---|
| PubChem CID | 118990875 |
| Molecular Formula | C9H3ClF6O |
| Molecular Weight | 276.56 g/mol |
| Exact Mass | 275.98 |
| IUPAC Name | 4-chloro-2,6-bis(trifluoromethyl)benzaldehyde |
| SMILES | O=Cc1c(C(F)(F)F)cc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C9H3ClF6O/c10-4-1-6(8(11,12)13)5(3-17)7(2-4)9(14,15)16/h1-3H |
| InChIKey | IQENMANFZPUBRE-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.56 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|