C10H3Cl2F7O — CID 118065573
2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzaldehyde (PubChem CID 118065573) has the molecular formula C10H3Cl2F7O and a molecular weight of 343.03 g/mol. Its IUPAC name is 2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzaldehyde.
| Compound Name | 2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzaldehyde |
|---|---|
| PubChem CID | 118065573 |
| Molecular Formula | C10H3Cl2F7O |
| Molecular Weight | 343.03 g/mol |
| Exact Mass | 341.94 |
| IUPAC Name | 2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzaldehyde |
| SMILES | O=Cc1c(Cl)cc(C(F)(C(F)(F)F)C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C10H3Cl2F7O/c11-6-1-4(2-7(12)5(6)3-20)8(13,9(14,15)16)10(17,18)19/h1-3H |
| InChIKey | XXPPRWVNMZWMBH-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.03 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|