C9H8ClFO — CID 84732821
3-chloro-5-fluoro-2,6-dimethylbenzaldehyde (PubChem CID 84732821) has the molecular formula C9H8ClFO and a molecular weight of 186.61 g/mol. Its IUPAC name is 3-chloro-5-fluoro-2,6-dimethylbenzaldehyde.
| Compound Name | 3-chloro-5-fluoro-2,6-dimethylbenzaldehyde |
|---|---|
| PubChem CID | 84732821 |
| Molecular Formula | C9H8ClFO |
| Molecular Weight | 186.61 g/mol |
| Exact Mass | 186.02 |
| IUPAC Name | 3-chloro-5-fluoro-2,6-dimethylbenzaldehyde |
| SMILES | Cc1c(F)cc(Cl)c(C)c1C=O |
| InChI | InChI=1S/C9H8ClFO/c1-5-7(4-12)6(2)9(11)3-8(5)10/h3-4H,1-2H3 |
| InChIKey | HKGIGEBOPNSCKW-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.61 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|