C8H7BF2O3 — CID 155293780
(3,5-difluoro-2-formyl-4-methylphenyl)boronic acid (PubChem CID 155293780) has the molecular formula C8H7BF2O3 and a molecular weight of 199.95 g/mol. Its IUPAC name is (3,5-difluoro-2-formyl-4-methylphenyl)boronic acid.
| Compound Name | (3,5-difluoro-2-formyl-4-methylphenyl)boronic acid |
|---|---|
| PubChem CID | 155293780 |
| Molecular Formula | C8H7BF2O3 |
| Molecular Weight | 199.95 g/mol |
| Exact Mass | 200.05 |
| IUPAC Name | (3,5-difluoro-2-formyl-4-methylphenyl)boronic acid |
| SMILES | Cc1c(F)cc(B(O)O)c(C=O)c1F |
| InChI | InChI=1S/C8H7BF2O3/c1-4-7(10)2-6(9(13)14)5(3-12)8(4)11/h2-3,13-14H,1H3 |
| InChIKey | HVKXGPWIEWMQQZ-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.95 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|