C9H7BrF3NO2 — CID 175425796
4-bromo-2,3,6-trifluorobenzaldehyde;N-ethylidenehydroxylamine (PubChem CID 175425796) has the molecular formula C9H7BrF3NO2 and a molecular weight of 298.06 g/mol. Its IUPAC name is 4-bromo-2,3,6-trifluorobenzaldehyde;N-ethylidenehydroxylamine.
| Compound Name | 4-bromo-2,3,6-trifluorobenzaldehyde;N-ethylidenehydroxylamine |
|---|---|
| PubChem CID | 175425796 |
| Molecular Formula | C9H7BrF3NO2 |
| Molecular Weight | 298.06 g/mol |
| Exact Mass | 296.96 |
| IUPAC Name | 4-bromo-2,3,6-trifluorobenzaldehyde;N-ethylidenehydroxylamine |
| SMILES | CC=NO.O=Cc1c(F)cc(Br)c(F)c1F |
| InChI | InChI=1S/C7H2BrF3O.C2H5NO/c8-4-1-5(9)3(2-12)6(10)7(4)11;1-2-3-4/h1-2H;2,4H,1H3 |
| InChIKey | ZQSCMJRQFOVKDT-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.06 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|