C7H3BrF2O2 — CID 53485944
5-bromo-3,4-difluoro-2-hydroxybenzaldehyde (PubChem CID 53485944) has the molecular formula C7H3BrF2O2 and a molecular weight of 237.00 g/mol. Its IUPAC name is 5-bromo-3,4-difluoro-2-hydroxybenzaldehyde.
| Compound Name | 5-bromo-3,4-difluoro-2-hydroxybenzaldehyde |
|---|---|
| PubChem CID | 53485944 |
| Molecular Formula | C7H3BrF2O2 |
| Molecular Weight | 237.00 g/mol |
| Exact Mass | 235.93 |
| IUPAC Name | 5-bromo-3,4-difluoro-2-hydroxybenzaldehyde |
| SMILES | O=Cc1cc(Br)c(F)c(F)c1O |
| InChI | InChI=1S/C7H3BrF2O2/c8-4-1-3(2-11)7(12)6(10)5(4)9/h1-2,12H |
| InChIKey | GZYDORINQPDUJX-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.00 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|