About 3,5-difluoro-2,4-dihydroxybenzaldehyde
3,5-difluoro-2,4-dihydroxybenzaldehyde (PubChem CID 18942327) has the molecular formula C7H4F2O3
and a molecular weight of 174.10 g/mol. Its IUPAC name is 3,5-difluoro-2,4-dihydroxybenzaldehyde.
Molecular Properties
| Compound Name | 3,5-difluoro-2,4-dihydroxybenzaldehyde |
| PubChem CID | 18942327 |
| Molecular Formula | C7H4F2O3 |
| Molecular Weight | 174.10 g/mol |
| Exact Mass | 174.01 |
| IUPAC Name | 3,5-difluoro-2,4-dihydroxybenzaldehyde |
| SMILES | O=Cc1cc(F)c(O)c(F)c1O |
| InChI | InChI=1S/C7H4F2O3/c8-4-1-3(2-10)6(11)5(9)7(4)12/h1-2,11-12H |
| InChIKey | HOGLWUCRFJBQOZ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.10 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3,5-difluoro-2,4-dihydroxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-difluoro-2,4-dihydroxybenzaldehyde?
The IUPAC name of 3,5-difluoro-2,4-dihydroxybenzaldehyde (CID 18942327) is 3,5-difluoro-2,4-dihydroxybenzaldehyde.
What is the SMILES notation for 3,5-difluoro-2,4-dihydroxybenzaldehyde?
The canonical SMILES for 3,5-difluoro-2,4-dihydroxybenzaldehyde is O=Cc1cc(F)c(O)c(F)c1O.
What is the InChIKey of 3,5-difluoro-2,4-dihydroxybenzaldehyde?
The InChIKey is HOGLWUCRFJBQOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4F2O3/c8-4-1-3(2-10)6(11)5(9)7(4)12/h1-2,11-12H.
What are the key properties of 3,5-difluoro-2,4-dihydroxybenzaldehyde?
3,5-difluoro-2,4-dihydroxybenzaldehyde has a molecular weight of 174.10 g/mol, XLogP of 1.19, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-difluoro-2,4-dihydroxybenzaldehyde is sourced from PubChem (CID 18942327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).