C8H6O4 — CID 19069872
4,5-dihydroxybenzene-1,3-dicarbaldehyde (PubChem CID 19069872) has the molecular formula C8H6O4 and a molecular weight of 166.13 g/mol. Its IUPAC name is 4,5-dihydroxybenzene-1,3-dicarbaldehyde.
| Compound Name | 4,5-dihydroxybenzene-1,3-dicarbaldehyde |
|---|---|
| PubChem CID | 19069872 |
| Molecular Formula | C8H6O4 |
| Molecular Weight | 166.13 g/mol |
| Exact Mass | 166.03 |
| IUPAC Name | 4,5-dihydroxybenzene-1,3-dicarbaldehyde |
| SMILES | O=Cc1cc(O)c(O)c(C=O)c1 |
| InChI | InChI=1S/C8H6O4/c9-3-5-1-6(4-10)8(12)7(11)2-5/h1-4,11-12H |
| InChIKey | YZJVWIUMDDXVEA-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.13 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|